![[ICO]](/icons/blank.gif) | Name | Last modified | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - |
![[DIR]](/icons/folder.gif) | Čapek, Karel/ | 2023-08-29 23:31 | - |
| Адамс, Дуглас/ | 2019-01-08 01:15 | - |
| Азимов, Айзек/ | 2020-09-30 17:24 | - |
| Андерсон, Пол/ | 2020-10-04 11:27 | - |
| Беляев, Александр/ | 2021-04-03 10:23 | - |
| Берроуз, Уильям/ | 2019-01-08 01:15 | - |
| Бредбери, Рэй/ | 2020-10-06 16:04 | - |
| Булычёв, Кир/ | 2024-06-12 17:24 | - |
| Бёрджесс, Энтони/ | 2019-01-08 01:15 | - |
| Вересаев, Викентий/ | 2022-12-19 14:13 | - |
| Верхарн, Эмиль/ | 2023-01-13 21:30 | - |
| Войнович, Владимир/ | 2021-10-15 23:05 | - |
| Гамсун, Кнут/ | 2019-01-08 01:15 | - |
| Гаррисон, Гарри/ | 2020-10-01 19:45 | - |
| Гашек, Ярослав/ | 2023-08-29 23:31 | - |
| Гессе, Герман/ | 2019-01-08 01:15 | - |
| Гиляровский, Владимир/ | 2022-12-20 17:12 | - |
| Голсуорси, Джон/ | 2019-01-08 01:15 | - |
| Джойс, Джеймс/ | 2019-01-08 01:15 | - |
| Драйзер, Теодор/ | 2019-01-08 01:15 | - |
| Замятин, Евгений/ | 2023-08-29 23:31 | - |
| Керуак, Джек/ | 2019-01-08 01:15 | - |
| Кларк, Артур/ | 2020-09-28 22:50 | - |
| Крапивин, Владислав/ | 2022-12-19 14:14 | - |
| Лагерлёф, Сельма/ | 2019-01-08 01:15 | - |
| Лем, Станислав/ | 2020-09-26 21:03 | - |
| Майринк, Густав/ | 2019-01-08 01:15 | - |
| Макьюэн, Иэн/ | 2019-01-08 01:15 | - |
| Маркуша, Анатолий/ | 2019-04-06 23:53 | - |
| Миллер, Генри/ | 2019-01-08 01:15 | - |
| Мильчин, Аркадий/ | 2022-12-19 14:14 | - |
| Муркок, Майкл/ | 2020-10-05 15:55 | - |
| Набоков, Владимир/ | 2022-11-20 18:53 | - |
| Оруэлл, Джордж/ | 2019-01-08 01:15 | - |
| Пелевин, Виктор/ | 2023-09-16 22:19 | - |
| Рюноскэ, Аутагава/ | 2019-01-08 01:15 | - |
| Саймак, Клиффорд/ | 2025-03-07 00:01 | - |
| Стругацкие/ | 2019-01-08 01:15 | - |
| Толстой, Алексей Н/ | 2023-08-29 23:31 | - |
| Фрай, Макс/ | 2025-03-17 12:28 | - |
| Фрост, Роберт/ | 2019-01-08 01:15 | - |
| Хаксли, Олдос/ | 2021-08-20 20:55 | - |
| Чапек, Карел/ | 2019-01-08 01:16 | - |
| Чуковский, Корней/ | 2023-01-01 14:37 | - |
| Шекли, Роберт/ | 2020-09-29 17:08 | - |
| Элтон, Бен/ | 2021-08-30 21:47 | - |
| Эргле, Зента/ | 2022-12-17 23:36 | - |
| Adams, Richard/ | 2021-09-30 11:00 | - |
| Adams, Scott/ | 2022-09-26 00:20 | - |
| Algeo, John/ | 2023-08-29 23:31 | - |
| Archer, Jeffrey/ | 2021-12-15 23:03 | - |
| Ardagh, Philip/ | 2024-05-16 21:43 | - |
| Arthur, Robert/ | 2021-07-08 15:23 | - |
| Asimov, Isaac/ | 2022-10-15 01:20 | - |
| Attenborough, David/ | 2022-12-16 17:28 | - |
| Atwood, Margaret/ | 2022-01-01 17:14 | - |
| Auden, Wystan Hugh/ | 2021-09-25 14:06 | - |
| Ballard, James/ | 2021-09-16 20:30 | - |
| Barfield, Owen/ | 2019-01-08 01:14 | - |
| Baum, L. Frank/ | 2023-08-29 23:31 | - |
| Beckett, Samuel/ | 2022-06-29 19:08 | - |
| Bellairs, John/ | 2023-08-29 23:31 | - |
| Blyton, Enid/ | 2020-12-24 20:30 | - |
| Boccaccio, Giovanni/ | 2022-12-17 14:19 | - |
| Bradbury, Ray/ | 2024-05-15 23:16 | - |
| Bragg, Melvyn/ | 2022-11-14 14:08 | - |
| Burgess, Anthony/ | 2021-09-02 15:56 | - |
| Burton, Tim/ | 2021-06-24 21:15 | - |
| Carroll, Lewis/ | 2022-12-11 23:57 | - |
| Chekhov, Anton/ | 2023-11-21 17:29 | - |
| Chesterton, Gilbert K/ | 2023-09-16 11:13 | - |
| Christie, Agata/ | 2023-08-08 00:34 | - |
| Clarke, Arthur C/ | 2022-10-18 19:58 | - |
| Conan Doyle, Arthur/ | 2022-12-06 17:55 | - |
| Coupland, Douglas/ | 2021-07-30 13:30 | - |
| Coward, Noël/ | 2021-08-21 13:01 | - |
| Crystal, David/ | 2022-11-03 16:01 | - |
| Dick, Philip K/ | 2021-08-30 20:18 | - |
| DuMaurier, Daphne/ | 2023-08-29 23:31 | - |
| Dunsany, Lord/ | 2021-08-18 13:02 | - |
| Durrell, Gerald/ | 2024-03-08 19:04 | - |
| Durrell, Lawrence/ | 2024-02-06 00:49 | - |
| Eliot, T S/ | 2023-08-26 01:24 | - |
| Elton, Ben/ | 2021-08-30 21:47 | - |
| Escher, M C/ | 2023-11-28 00:01 | - |
| Fowler, Henry/ | 2023-08-29 23:31 | - |
| French, Vivian/ | 2021-07-30 13:34 | - |
| Fry, Stephen/ | 2024-05-15 23:25 | - |
| Gibson, William/ | 2021-08-23 16:08 | - |
| Gilliam, Terry/ | 2024-01-28 02:52 | - |
| Gorey, Edward/ | 2023-08-29 23:31 | - |
| Hašek, Jaroslav/ | 2023-08-29 23:31 | - |
| Heinlein, Robert/ | 2021-09-30 11:29 | - |
| Huxley, Aldous/ | 2021-08-21 13:01 | - |
| Idle, Eric/ | 2021-10-08 23:00 | - |
| James, Lawrence/ | 2022-10-13 17:36 | - |
| James, M R/ | 2022-06-29 16:00 | - |
| Jansson, Tove/ | 2022-12-31 19:45 | - |
| Jones, Terry/ | 2022-04-04 23:43 | - |
| Joyce, James/ | 2022-05-14 22:09 | - |
| Kafka, Franz/ | 2022-08-28 00:08 | - |
| King, Stephen/ | 2025-04-25 01:36 | - |
| Kipling, Rudyard/ | 2023-10-11 00:17 | - |
| Kirov, Erica/ | 2022-11-17 22:50 | - |
| Laurie, Hugh/ | 2021-10-07 15:35 | - |
| Lawson, Mark/ | 2020-11-24 17:00 | - |
| Laymon, Richard/ | 2019-01-08 01:14 | - |
| Lear, Edward/ | 2021-05-30 12:51 | - |
| LeGuin, Ursula K/ | 2023-08-29 23:31 | - |
| Lem, Stanisław/ | 2021-09-16 10:40 | - |
| Lewis, Clive Staples/ | 2023-08-29 23:31 | - |
| London, Jack/ | 2021-08-20 23:26 | - |
| Lovecraft, Howard Philips/ | 2023-08-29 23:31 | - |
| Massie, Robert K/ | 2022-12-28 14:06 | - |
| McLuhan, Marshall/ | 2023-01-13 22:09 | - |
| Meloy, Maile/ | 2022-10-18 19:31 | - |
| Milligan, Spike/ | 2021-10-12 10:33 | - |
| Murphy, Jill/ | 2024-02-13 13:59 | - |
| Nabokov, Vladimir/ | 2023-08-29 23:31 | - |
| Orwell, George/ | 2023-08-29 23:31 | - |
| Palin, Michael/ | 2021-10-08 23:09 | - |
| Partridge, Eric/ | 2022-11-06 23:27 | - |
| Paxman, Jeremy/ | 2023-02-28 00:33 | - |
| Peake, Mervyn/ | 2022-10-24 18:29 | - |
| Pipes, Richard/ | 2022-11-16 23:31 | - |
| Poe, Edgar Allan/ | 2023-08-29 23:31 | - |
| Pohl, Frederick/ | 2021-09-30 12:21 | - |
| Pushkin, Alexander/ | 2022-11-24 22:59 | - |
| Quirk, Randolph/ | 2022-11-11 17:48 | - |
| Rabelais, François/ | 2023-08-29 23:31 | - |
| Rand, Ayn/ | 2023-08-29 23:31 | - |
| Sacks, Oliver/ | 2022-12-27 16:19 | - |
| Sagan, Carl/ | 2021-08-31 11:23 | - |
| Schama, Simon/ | 2022-09-15 23:47 | - |
| Shakespeare, William/ | 2023-08-29 23:31 | - |
| Sheckley, Robert/ | 2022-09-29 01:07 | - |
| Simak, Clifford D/ | 2021-08-30 14:32 | - |
| Spenser, Edmund/ | 2023-08-29 23:31 | - |
| Steinbeck, John/ | 2019-01-08 01:15 | - |
| Strugatsky & Strugatsky/ | 2023-11-21 17:33 | - |
| Thompson, Hunter S/ | 2024-01-27 23:54 | - |
| Toffler, Alan/ | 2025-08-23 17:42 | - |
| Tolkien, John Ronald Reuel/ | 2022-11-16 23:18 | - |
| Tolstoy, Leo/ | 2022-11-25 00:05 | - |
| Travers, Pamela/ | 2022-03-16 22:02 | - |
| Twain, Mark/ | 2021-09-30 00:01 | - |
| Ullman, Ellen/ | 2021-07-18 23:31 | - |
| Vonnegut, Kurt/ | 2022-03-20 16:50 | - |
| Wahlöö, Per/ | 2023-03-04 21:25 | - |
| Wallace, David Foster/ | 2023-02-28 00:19 | - |
| Weiss, Jan/ | 2023-08-29 23:31 | - |
| Wodehouse, GP/ | 2023-08-23 15:15 | - |
| Worst Alphabet Book Ever/ | 2021-04-03 10:23 | - |
| _хуй/ | 2021-04-03 10:23 | - |
| _alcohol & cocktailcrafting/ | 2023-08-29 23:31 | - |
| _alignments/ | 2025-03-13 21:44 | - |
| _architecture/ | 2023-04-24 19:52 | - |
| _archive/ | 2019-10-19 22:05 | - |
| _aroma fragrance herbs oils spices/ | 2025-03-17 23:16 | - |
| _art movies/ | 2023-08-29 23:31 | - |
| _astronomy/ | 2024-03-29 13:59 | - |
| _bdsm/ | 2021-04-03 10:23 | - |
| _botany/ | 2023-08-29 23:31 | - |
| _calligraphy lettering ornaments/ | 2022-12-10 16:34 | - |
| _cars/ | 2025-07-14 21:45 | - |
| _cats/ | 2023-08-29 23:31 | - |
| _chem - Учебники и задачники/ | 2023-08-29 23:31 | - |
| _chem - analit metrology/ | 2021-10-02 17:13 | - |
| _chem - colloid/ | 2021-09-28 11:31 | - |
| _chem - coordination/ | 2022-10-14 13:26 | - |
| _chem - crystal/ | 2024-10-14 23:40 | - |
| _chem - dye color paint/ | 2024-07-14 23:03 | - |
| _chem - experiments/ | 2023-09-29 23:32 | - |
| _chem - general/ | 2025-05-15 01:00 | - |
| _chem - glass ceramic/ | 2023-11-08 00:01 | - |
| _chem - hazard/ | 2021-04-03 10:23 | - |
| _chem - history/ | 2023-09-29 23:26 | - |
| _chem - household/ | 2021-10-06 15:14 | - |
| _chem - indicators/ | 2021-04-03 10:23 | - |
| _chem - inorg/ | 2023-08-29 23:31 | - |
| _chem - inorg_preparative/ | 2022-09-10 16:20 | - |
| _chem - laboratory/ | 2024-07-14 22:57 | - |
| _chem - nomenclature/ | 2024-12-31 01:01 | - |
| _chem - org/ | 2025-05-15 01:00 | - |
| _chem - org_ancient/ | 2024-06-12 17:24 | - |
| _chem - org_metallica/ | 2024-12-31 01:01 | - |
| _chem - org_preparative/ | 2024-07-14 22:50 | - |
| _chem - org_textbooks/ | 2025-05-15 01:00 | - |
| _chem - physchem/ | 2023-03-02 01:13 | - |
| _chem - polymer/ | 2021-10-04 18:03 | - |
| _chem - pop/ | 2025-05-15 01:00 | - |
| _chem - quantum computation/ | 2021-10-06 15:00 | - |
| _chem - solvent/ | 2021-09-23 13:07 | - |
| _chem - spectra/ | 2023-08-29 23:31 | - |
| _chem - spectra_mass/ | 2023-08-29 23:31 | - |
| _chem - spectra_nmr/ | 2023-08-29 23:31 | - |
| _chem - sprav & dict/ | 2021-09-23 11:46 | - |
| _chem - stereo bond molecular_geometry/ | 2023-08-29 23:31 | - |
| _chem - supramolecular/ | 2023-08-29 23:31 | - |
| _chem - tech/ | 2024-07-14 22:56 | - |
| _chem - thermoanalysis/ | 2021-04-03 10:23 | - |
| _chem - tox & warfare/ | 2025-03-13 20:25 | - |
| _chem/ | 2025-05-01 20:14 | - |
| _children/ | 2023-11-21 14:39 | - |
| _comedy/ | 2023-10-29 20:24 | - |
| _comic_poetry limerick nonsense_verse/ | 2023-08-29 23:31 | - |
| _cooking/ | 2024-09-19 15:25 | - |
| _covers page samples/ | 2021-04-03 15:35 | - |
| _cyberpunk/ | 2021-04-03 10:23 | - |
| _design infographic/ | 2025-05-15 01:00 | - |
| _deutsch/ | 2022-10-16 23:50 | - |
| _dictionaries/ | 2025-05-15 01:00 | - |
| _distillation/ | 2023-08-29 23:31 | - |
| _diy - dye/ | 2021-10-04 18:08 | - |
| _diy - electric/ | 2023-08-29 23:31 | - |
| _diy - electronic/ | 2025-02-20 18:58 | - |
| _diy - galvanic/ | 2023-08-29 23:31 | - |
| _diy - house bath furnace/ | 2021-04-03 10:23 | - |
| _diy - household chem/ | 2021-04-03 10:23 | - |
| _diy - leatherworking/ | 2021-04-03 10:23 | - |
| _diy - metalworking/ | 2021-04-03 10:23 | - |
| _diy - painting/ | 2021-04-03 10:23 | - |
| _diy - sewing/ | 2021-04-03 10:23 | - |
| _diy - soapmaking/ | 2024-07-14 22:55 | - |
| _diy - welding/ | 2024-06-27 23:32 | - |
| _diy - woodworking/ | 2023-08-29 23:31 | - |
| _diy/ | 2024-09-06 23:00 | - |
| _drawing/ | 2021-04-03 10:23 | - |
| _dystopia utopia/ | 2025-05-15 01:00 | - |
| _economics/ | 2021-06-11 11:27 | - |
| _encyclopædias/ | 2023-04-28 01:36 | - |
| _english - (mis)usage/ | 2022-12-08 21:52 | - |
| _english - culture identity/ | 2023-11-21 15:11 | - |
| _english - dialects jargon slang/ | 2024-05-15 23:23 | - |
| _english - etymology (catchphrases cliches euphemisms eponyms fable foreign phrases sayings quotations)/ | 2023-08-29 23:31 | - |
| _english - fuck!/ | 2022-11-07 15:17 | - |
| _english - grammar/ | 2025-05-15 01:00 | - |
| _english - language history/ | 2024-10-02 23:08 | - |
| _english - literature/ | 2023-08-29 23:31 | - |
| _english - old/ | 2023-08-29 23:31 | - |
| _english - politics/ | 2022-12-16 00:39 | - |
| _english - style & writing/ | 2023-08-29 23:31 | - |
| _entomology/ | 2021-04-03 10:23 | - |
| _faces/ | 2021-05-22 22:50 | - |
| _fairy tales/ | 2023-09-04 00:26 | - |
| _FFVII/ | 2023-08-29 23:31 | - |
| _film noir/ | 2023-01-13 23:49 | - |
| _fonts/ | 2025-03-07 00:01 | - |
| _food taste flavour/ | 2023-09-29 23:40 | - |
| _gemology/ | 2021-04-03 10:23 | - |
| _glassblowing/ | 2023-09-14 00:35 | - |
| _greenhouse I/ | 2019-09-22 17:52 | - |
| _greenhouse II/ | 2020-07-02 14:00 | - |
| _harmonica/ | 2019-01-07 22:37 | - |
| _harmonography/ | 2021-04-03 10:23 | - |
| _hifi/ | 2021-04-03 10:23 | - |
| _history - british/ | 2023-11-21 15:08 | - |
| _history - french rev/ | 2023-08-29 23:31 | - |
| _history - roman/ | 2023-08-29 23:31 | - |
| _history - russian/ | 2025-05-15 01:00 | - |
| _history - ww1/ | 2023-12-04 23:48 | - |
| _history - ww2/ | 2023-08-29 23:31 | - |
| _history/ | 2025-08-23 17:42 | - |
| _inc/ | 2021-06-02 23:20 | - |
| _IT/ | 2024-12-31 01:01 | - |
| _katabasian/ | 2023-02-13 18:08 | - |
| _latin/ | 2023-08-29 23:31 | - |
| _logic/ | 2021-10-01 12:26 | - |
| _maps and subway schemes/ | 2024-09-06 23:33 | - |
| _math - graphs (+ python)/ | 2023-08-29 23:31 | - |
| _math - polyhedra/ | 2023-08-29 23:31 | - |
| _math - sets/ | 2023-08-29 23:31 | - |
| _math/ | 2025-08-23 17:42 | - |
| _MtG/ | 2023-11-01 01:33 | - |
| _music/ | 2025-06-29 20:10 | - |
| _myth/ | 2025-05-15 01:00 | - |
| _old tech/ | 2025-05-15 01:00 | - |
| _outdoors survival/ | 2022-12-16 14:21 | - |
| _periodic table/ | 2024-04-24 14:39 | - |
| _pharm I/ | 2024-07-14 23:00 | - |
| _pharm II/ | 2023-08-29 23:31 | - |
| _pharm III/ | 2024-09-11 13:23 | - |
| _philology linguistic/ | 2022-10-17 00:23 | - |
| _philosophy/ | 2023-08-29 23:31 | - |
| _physics/ | 2021-04-03 10:23 | - |
| _poetry/ | 2023-08-29 23:31 | - |
| _posters/ | 2023-08-29 23:31 | - |
| _printing bookbinding/ | 2021-04-03 10:23 | - |
| _psychology/ | 2024-01-21 12:11 | - |
| _pyro I/ | 2023-08-29 23:31 | - |
| _pyro II/ | 2023-08-29 23:31 | - |
| _resistance/ | 2024-06-12 17:24 | - |
| _russian - etymology/ | 2023-08-29 23:31 | - |
| _russian - grammar/ | 2025-05-15 01:00 | - |
| _russian - linguistics/ | 2022-11-23 23:28 | - |
| _russian - literature/ | 2023-08-29 23:31 | - |
| _russian - soviet propaganda/ | 2025-08-23 17:42 | - |
| _russian - style & writing/ | 2023-08-29 23:31 | - |
| _schoolbooks/ | 2023-08-29 23:31 | - |
| _sci fi/ | 2022-11-06 00:34 | - |
| _sci fi collections/ | 2025-04-23 16:50 | - |
| _sci pop/ | 2025-05-15 01:00 | - |
| _sitcom/ | 2023-08-29 23:31 | - |
| _socio politic/ | 2023-08-29 23:31 | - |
| _space/ | 2021-04-03 10:23 | - |
| _statistics & terver/ | 2024-03-27 01:48 | - |
| _steampunk/ | 2022-09-03 18:57 | - |
| _style editing grammar/ | 2021-07-21 10:57 | - |
| _svenska/ | 2024-08-30 14:42 | - |
| _symbols/ | 2022-09-21 00:45 | - |
| _syracuse/ | 2023-08-29 23:31 | - |
| _tea/ | 2025-05-15 01:00 | - |
| _typography/ | 2023-08-29 23:31 | - |
| _vexillology heraldics/ | 2025-07-03 00:29 | - |
| _war & civil defence/ | 2025-05-15 01:00 | - |
| _war - insignia & uniforms/ | 2023-09-12 22:04 | - |
| _yiddish/ | 2022-09-22 15:13 | - |
| _zoology/ | 2021-03-04 22:43 | - |
| __Азбука-классика (pocket-book)/ | 2019-01-08 00:18 | - |
| __Библиотека Всемирной Литературы/ | 2023-01-13 21:29 | - |
| __Библиотека Приключений/ | 2025-04-25 01:29 | - |
| __Библиотека Современной Фантастики/ | 2025-04-25 01:31 | - |
| __Библиотека приключений и научной фантастики/ | 2025-04-25 01:31 | - |
| __Зарубежная фантастика/ | 2020-08-30 18:37 | - |
| __Иностранная литература. Большие книги/ | 2019-01-08 00:21 | - |
| __Мир Приключений/ | 2019-01-08 00:43 | - |
| __Шедевры Фантастики - Продолжатели/ | 2019-01-08 01:17 | - |
| __Шедевры Фантастики/ | 2019-01-08 01:16 | - |
| __ЭСЮ/ | 2021-04-03 10:23 | - |
| __A Very Short Introduction/ | 2023-09-04 00:23 | - |
| __For Dummies Book Collection/ | 2019-03-16 16:10 | - |
| __Penguin Classics/ | 2020-04-28 13:48 | - |
| __Wiley Book Collection/ | 2020-12-28 11:58 | - |
| ___журналы/ | 2025-08-23 13:36 | - |
![[ ]](/icons/layout.gif) | Аронов Александр Избранное 2014.pdf | 2020-08-16 09:58 | 1.4M |
| Владимир Стеценко - Самоучитель игры на сноуборде.pdf | 2016-12-12 00:24 | 2.3M |
| Вышнепольский И.С. 1981 Техническое черчение.pdf | 2018-10-07 18:15 | 33M |
| Демин В., Демина-Ламберт О. - Добро пожаловать в Америку. Полное руководство для иммигрантов - 2003.pdf | 2016-11-22 09:53 | 42M |
| Дятчин Н.И. 2001 История развития техники.pdf | 2019-12-02 00:11 | 16M |
| Житков Б.С. - Что я видел, Детская литература, 1979г..pdf | 2022-12-28 14:53 | 30M |
![[ ]](/icons/unknown.gif) | Келлерман Бернгард. Туннель - royallib.ru.doc | 2013-09-17 20:16 | 723K |
| Песенник.doc | 2007-05-16 01:07 | 307K |
![[ ]](/icons/odf6odt-20x22.png) | Песенник.odt | 2007-08-16 00:54 | 62K |
![[IMG]](/icons/image2.gif) | 8bit.jpg | 2020-07-03 14:11 | 14M |
| 12 gothic tales.pdf | 2021-07-10 14:35 | 12M |
| 501 must-visit cities.pdf | 2021-05-29 16:23 | 228M |
| 1898 - Замечательные чудаки и оригиналы.pdf | 2022-12-29 23:44 | 13M |
| 1907 - Цветы зла.pdf | 2022-12-29 23:40 | 35M |
| 1923 - Кристабель.pdf | 2022-12-29 17:57 | 2.0M |
| 1927 - Числовые суеверия.pdf | 2022-12-29 22:38 | 7.0M |
| 1932 - Техника сладострастия.pdf | 2023-02-18 16:39 | 96M |
| 1940 - Международный атлас облаков и состояний неба.pdf | 2020-12-13 15:44 | 62M |
| 1612343739-711703565efb87d63d4ea047613b0bcc.jpeg | 2021-05-05 10:12 | 81K |
| advisland.jpg | 2020-06-14 23:48 | 490K |
| A Fish Called Wanda.pdf | 2021-10-12 13:24 | 4.7M |
| A generation in motion - popular music and culture in the sixties.pdf | 2021-05-16 15:50 | 30M |
| A History of Technology 1 - From Early Times to Fall of Ancient Empires c. 500BC.pdf | 2022-09-24 00:23 | 107M |
| A History of Technology 5 - The Late Nineteenth Century c.1850 - c.1900.pdf | 2022-09-24 00:24 | 64M |
| A Little Book of Language.pdf | 2021-10-01 22:16 | 4.0M |
| A Little History of Economics.pdf | 2021-10-02 10:47 | 2.3M |
| A Little History of Literature.pdf | 2021-10-02 10:46 | 14M |
| A Little History of Philosophy.pdf | 2021-10-01 22:18 | 1.6M |
| A Little History of Religion.pdf | 2021-10-02 10:47 | 2.9M |
| A Little History of Science.pdf | 2021-10-02 10:47 | 3.5M |
| A Little History of the United States.pdf | 2021-10-02 12:54 | 6.2M |
| A Little History of the World (Illustrated Edition).pdf | 2021-10-02 12:54 | 39M |
| A Little History of the World.pdf | 2021-10-02 10:47 | 8.7M |
| alphabet.jpg | 2022-11-07 23:53 | 85K |
| alphabet2.jpg | 2023-02-27 23:16 | 13K |
| A reference guide to film genres.pdf | 2023-01-13 22:49 | 27M |
| A Seaman's Pocket-book, June 1943.pdf | 2022-10-01 17:52 | 5.3M |
| A Short History of Technology - From the Earliest times to A.D. 1900, Derry.pdf | 2022-09-24 00:13 | 47M |
| Asimov, Isaac - On Numbers.pdf | 2021-06-04 12:13 | 7.7M |
| A small book of grave humour - comic & curious memorial inscriptions.pdf | 2021-07-23 11:06 | 15M |
| Atmospheric chemistry and physics - From air pollution to climate change.pdf | 2021-09-24 15:18 | 67M |
| A Treasury of Fantasy - Heroic Adventures in Imaginary Lands.pdf | 2021-08-18 22:01 | 36M |
| A year in the merde.pdf | 2021-05-22 13:42 | 8.6M |
| Berg_The_Theory_and_Application_of_Precision_Mechanical_Components_1965.pdf | 2020-12-28 19:36 | 16M |
| Big black book 2002.pdf | 2020-12-09 00:53 | 99M |
| Bloomsbury good reading guide.pdf | 2022-12-30 01:07 | 20M |
| Carl Sagan - a biography.pdf | 2023-03-04 19:49 | 9.0M |
| Catch-22, Heller 1955.pdf | 2022-12-28 17:37 | 24M |
| Classical Literature - A Concise History (Blackwell Introductions to the Classical World).pdf | 2021-10-01 12:26 | 1.8M |
| Color, Zelanski 2010.pdf | 2021-02-16 12:58 | 22M |
| Creepy Susie.pdf | 2005-11-30 11:26 | 850K |
| Cyrano de Bergerac (Burgess).pdf | 2021-09-30 00:00 | 6.6M |
| Cyrano de Bergerac (Rostand).pdf | 2021-09-30 00:00 | 24M |
| Dark Imaginings - a Collection of Gothic Fantasy.pdf | 2021-08-18 22:03 | 21M |
| Data structures - form and function.pdf | 2022-10-25 15:34 | 34M |
| Djonny_-_Skazki_temnogo_lesa.pdf | 2023-01-19 01:40 | 8.8M |
| Don't Look Now - British Cinema in the 1970s.pdf | 2021-10-08 23:43 | 1.0M |
| dope.jpg | 2020-10-27 18:57 | 169K |
| Educational_Charts_Arms_amp_amp_Armour_1917.pdf | 2018-10-07 14:08 | 3.0M |
| Encyclopedia Idiotica, Weir 2005.pdf | 2022-09-15 00:02 | 11M |
| Encyclopedia of Beat Literature.pdf | 2019-03-31 10:26 | 3.0M |
| EncyclopediaOfUnusualSexPractices.pdf | 2019-03-31 15:24 | 82M |
| Eric Moltke. Runes and their origin. 1985.pdf | 2020-04-19 18:25 | 154M |
| Everyday Fashions of the 40s as Pictured in Sears Catalogs.pdf | 2016-11-23 20:54 | 22M |
| Fairy tales for computers.pdf | 2022-08-27 18:29 | 16M |
| Felines - Great Poets on Notorious Cats.pdf | 2021-05-30 16:38 | 3.7M |
| Figuratively Speaking.pdf | 2021-10-08 23:12 | 366K |
| Final-Fantasy-VII-Versus-Guide.pdf | 2021-05-17 23:07 | 17M |
| Final Fantasy IX Bradygames Strategy Guide.pdf | 2021-05-18 10:17 | 109M |
| Final Fantasy IX Official Strategy Guide.pdf | 2021-09-27 22:41 | 146M |
| Final Fantasy Tactics A2 Grimoire of the Rift Bradygames Strategy Guide.pdf | 2021-05-18 10:18 | 113M |
| Final Fantasy Tactics Advance.pdf | 2021-09-27 22:44 | 63M |
| Final Fantasy Tactics Advance Player's Guide.pdf | 2021-05-18 10:18 | 63M |
| Final Fantasy Tactics War of The Lions Bradygames Strategy Guide.pdf | 2021-05-18 10:18 | 122M |
| Final Fantasy VII (Bradygames Strategy Guide).pdf | 2021-05-18 08:05 | 101M |
| Final Fantasy VII - Versus Books Ultimate Guide.pdf | 2021-09-27 22:41 | 54M |
| Final Fantasy VIII.pdf | 2021-05-18 10:03 | 208M |
| Final fantasy X-2 official strategy guide.pdf | 2021-09-27 22:42 | 155M |
| Final Fantasy XIII Guide.pdf | 2021-09-27 22:45 | 163M |
| Frankenstein (Graphic Horror).pdf | 2021-09-28 23:58 | 2.1M |
| Frankenstein - complete, authoritative text.pdf | 2023-03-02 23:59 | 31M |
| Fred Dibnah's Buildings of Britain.pdf | 2021-07-22 21:42 | 16M |
| frei.xls | 2007-02-24 23:22 | 14K |
| From two to five.pdf | 2022-12-30 15:22 | 10M |
| Galaxy_1954_11.pdf | 2021-06-04 15:19 | 59M |
| Gargantua - Manufactured Mass Culture, Stallabrass 1996.pdf | 2022-12-03 23:13 | 11M |
| George Friedman - The next 100 years - a forecast for the 21st century.pdf | 2022-04-03 12:54 | 14M |
| George Friedman - The next decade - where we've been and where we're going.pdf | 2022-04-03 14:08 | 37M |
| halloween_mb_story.pdf | 2005-11-29 20:50 | 174K |
| Handbook of Cultural geography.pdf | 2021-09-28 23:58 | 13M |
| Hark! - a vagrant.pdf | 2021-05-30 17:30 | 21M |
| Haunts, haunts, haunts.pdf | 2021-08-18 22:01 | 17M |
| Heller_Ulovka_22.pdf | 2023-01-20 17:26 | 2.4M |
| Hogben-TheVocabularyOfScience.pdf | 2019-03-31 18:19 | 5.2M |
| hormegeddon-full-book-digital.pdf | 2020-07-15 01:39 | 2.4M |
| Horrible Histories - Barmy British Empire.epub | 2021-09-29 14:13 | 14M |
| Horrible Histories - Dublin.epub | 2021-10-15 12:42 | 13M |
| Horrible Histories - Special - France.pdf | 2021-09-28 23:48 | 13M |
| Horrible Histories - Special - London.pdf | 2021-09-28 23:48 | 10M |
| Horrible Histories - Stormin' Normans.pdf | 2021-09-28 23:44 | 29M |
| Horrible Histories - The Angry Aztecs.pdf | 2021-09-28 23:45 | 30M |
| Horrible Histories - The Awesome Egyptians.pdf | 2021-09-28 23:45 | 29M |
| Horrible Histories - The Blitzed Brits.pdf | 2021-09-28 23:43 | 31M |
| Horrible Histories - The Incredible Incas.pdf | 2021-09-28 23:46 | 9.3M |
| Horrible Histories - The Ruthless Romans.pdf | 2021-09-28 23:43 | 29M |
| Horrible Histories - The Terrible Tudors.pdf | 2021-09-28 23:46 | 29M |
| Horrible Histories - The Villainous Victorians.pdf | 2021-09-28 23:44 | 28M |
| Hyperbole in English - A Corpus-based Study of Exaggeration.pdf | 2021-10-08 23:15 | 2.8M |
| Illustrated_Sourcebook_Of_Mechanical_Components.pdf | 2020-12-28 19:08 | 92M |
| indicasativa.jpg | 2019-12-29 22:10 | 132K |
| Industrial archaeology - a new introduction.pdf | 2021-07-22 21:39 | 14M |
| International Biographical Dictionary of Computer Pioneers, Lee 1995.pdf | 2022-09-13 15:50 | 154M |
| komissarov.pdf | 2023-02-06 16:32 | 813K |
| komissarov2.pdf | 2023-02-06 16:35 | 1.8M |
| Kondratov-Sounds-and-Signs-Mir-1969.pdf | 2019-03-27 23:49 | 6.4M |
| lava-lamp.pdf | 2020-08-03 18:01 | 475K |
| libraries | 2016-06-16 16:42 | 37 |
| London, 1991.pdf | 2022-09-13 15:57 | 24M |
| Lonely Planet - Russia.pdf | 2022-11-22 17:00 | 46M |
| Lord Dunsany - Over the hills and far away.pdf | 2022-09-03 17:56 | 13M |
| Lost buildings of Britain.pdf | 2021-07-22 21:46 | 18M |
| lovecraft.png | 2016-06-30 17:33 | 370K |
| Marijuana.pdf | 2021-08-05 21:09 | 13M |
| Masters of American Comics.pdf | 2023-01-12 01:26 | 51M |
| Materials handbook.pdf | 2022-10-30 23:47 | 82M |
| Men Against Fire - the problem of battle command in future war, S.L.A.Marshall 1947.pdf | 2023-04-28 14:30 | 9.7M |
| Michael Starks Marijuana Chemistry Ronin Publishing 1993.pdf | 2021-09-21 05:48 | 99M |
| Monsters, monsters, monsters.pdf | 2021-08-18 22:00 | 18M |
| More Letters of Note - Correspondence Deserving of a Wider Audience.pdf | 2024-02-18 21:28 | 98M |
| movies.png | 2014-11-26 10:15 | 263K |
| Narodnoe_nasledie_o_primetakh_pogody_Kalendar.pdf | 2017-01-08 22:21 | 5.5M |
| Obsolete - an encyclopedia of once-common things passing us by.pdf | 2021-05-16 12:13 | 22M |
| Old Possums book of practical cats.pdf | 2021-05-28 13:55 | 7.2M |
| Orders, decorations and insignia, military and civil.pdf | 2022-10-20 13:49 | 16M |
| OST_4G_0425.001.pdf | 2022-10-28 00:05 | 4.8M |
| Otto_V__934__-_Dionis_Mif_i_kult-2016.pdf | 2017-04-01 15:35 | 5.0M |
| Pashkovsky_V.E._-_Psihicheskie_rasstroystva_s_religiozno-misticheskimi_perejivaniyami.pdf | 2016-11-18 11:13 | 14M |
| pfukmoyTbnk.jpg | 2018-08-09 18:57 | 568K |
| Pigmares - porcine poems of the silver screen.pdf | 2021-05-30 13:03 | 17M |
| Plungyan_Pochemu-yazyki-takie-raznye.XPKU3w.259935.fb2 | 2016-12-11 04:32 | 1.7M |
| poe lovecraft.jpg | 2016-11-10 00:14 | 474K |
| Postmodernism for beginners.pdf | 2023-01-12 01:23 | 12M |
| Psychopathia sexualis.pdf | 2023-01-07 00:33 | 18M |
| QPB science encyclopedia.pdf | 2022-10-25 16:04 | 124M |
| raven.odt | 2012-09-11 17:40 | 15K |
| Roleder_-_Onanizm_1927.pdf | 2017-05-07 22:51 | 33M |
| Routledge encyclopedia of translation studies, 2ed 2009.pdf | 2022-11-22 00:22 | 59M |
| Rowan Atkinson.pdf | 2021-06-23 10:37 | 17M |
| Rybnikova_M_A_Russkie_poslovitsy_i_pogovorki.pdf | 2017-01-07 19:51 | 48M |
| saint robots.jpg | 2022-07-25 00:52 | 224K |
| Sisson's word and expression locater.pdf | 2021-07-22 23:30 | 29M |
| Styikalin_Sovetskaya_satiricheskaya_pechat_1917-1963_RuLit_Net.fb2 | 2012-06-08 14:53 | 17M |
| Sugar and spice.pdf | 2021-07-27 13:02 | 30M |
| sync.ffs_db | 2019-10-28 23:57 | 483K |
| textbook-of-engineering-drawing.pdf | 2021-09-29 00:00 | 17M |
| The 20th Century Book - Its Illustration and Design.pdf | 2021-05-30 17:25 | 28M |
| The 100 Most Important Chemical Compounds A Reference Guide.pdf | 2020-04-07 08:33 | 5.5M |
| The atlas of British railway history.pdf | 2022-09-19 18:48 | 15M |
| The basics of chemistry.pdf | 2023-01-07 00:40 | 19M |
| The Bluejacket's Manual.pdf | 2022-10-01 18:11 | 32M |
| The British Army.pdf | 2022-10-01 18:17 | 20M |
| The Cambridge history of modernism.pdf | 2022-11-22 19:23 | 54M |
| The chemistry of food.pdf | 2023-01-07 00:39 | 100M |
| The Dictionary of British Book Illustrators and Caricaturists 1800-1914, Houfe 2ed 1981.pdf | 2022-11-24 22:20 | 91M |
| The divine comedy - the inferno, the purgatorio, and the paradiso.pdf | 2022-08-27 23:52 | 41M |
| The Fantasy Book - An Illustrated History from Dracula to Tolkien.pdf | 2021-08-01 22:11 | 20M |
| The Film Snob's Dictionary.pdf | 2021-05-18 19:53 | 13M |
| The good, the bad and the mad - some weird people in American history.pdf | 2022-09-03 15:36 | 11M |
| The Great Admirals - Command at Sea 1587-1945, Sweetman 1997.pdf | 2022-12-02 19:23 | 31M |
| The Horror Megapack_ 25 Classic and Modern Horror Stories.pdf | 2021-09-29 00:00 | 1.7M |
| The Illuminatus Trilogy - Robert Shea.pdf | 2023-02-15 00:57 | 4.9M |
| The Illuminatus Trilogy.pdf | 2021-12-25 00:02 | 3.3M |
| The illuminatus trilogy alt.pdf | 2021-12-25 00:02 | 3.6M |
| The Mammoth Book of Arthurian Legends.pdf | 2022-10-13 17:20 | 75M |
| The Mammoth Book of Awesome Comic Fantasy.pdf | 2022-10-11 16:06 | 15M |
| The Mammoth Book of Best New Erotica, Volume 5.pdf | 2022-10-11 16:23 | 16M |
| The Mammoth Book of British Kings & Queens.pdf | 2022-10-13 17:21 | 54M |
| The Mammoth Book of Comic Fantasy.pdf | 2022-10-11 16:15 | 60M |
| The Mammoth Book of Cult Comics.pdf | 2022-10-13 16:17 | 36M |
| The Mammoth Book of Dieselpunk.pdf | 2022-02-04 23:50 | 25M |
| The Mammoth Book of Dirty, Sick, X-rated & Politically Incorrect Jokes.pdf | 2022-10-13 16:14 | 20M |
| The Mammoth Book of Erotica.pdf | 2022-10-13 15:53 | 74M |
| The Mammoth Book of Fairy Tales.pdf | 2022-10-13 17:20 | 22M |
| The Mammoth Book of Golden Age Detective Stories.pdf | 2022-10-11 16:01 | 61M |
| The Mammoth Book of Great Detective Stories.pdf | 2022-10-11 16:05 | 76M |
| The Mammoth Book of International Erotica.pdf | 2022-10-13 16:08 | 62M |
| The Mammoth Book of Merlin.pdf | 2022-10-13 16:09 | 16M |
| The Mammoth Book of Modern Science Fiction - Short Novels of The 1980s.pdf | 2022-10-11 16:02 | 60M |
| The Mammoth Book of New Comic Fantasy.pdf | 2022-10-13 17:20 | 26M |
| The Mammoth Book of New World Science Fiction - Short Novels of the 1960s.pdf | 2022-10-11 16:04 | 26M |
| The Mammoth Book of Sex, Drugs & Rock n roll.pdf | 2022-10-13 16:15 | 20M |
| The Mammoth Book of Sorcerers' Tales.pdf | 2022-10-14 01:38 | 24M |
| The Mammoth Book of Steampunk Adventures.pdf | 2021-08-19 12:09 | 16M |
| The Mammoth Book of the Lost Chronicles of Sherlock Holmes.pdf | 2022-10-11 16:14 | 24M |
| The Mammoth Book of Vintage Science Fiction - Short Novels of the 1950s.pdf | 2022-10-11 16:03 | 71M |
| The Mammoth Book of Zingers, Quips and One-liners.pdf | 2022-10-14 01:12 | 30M |
| The metamorphoses of Ovid.pdf | 2024-06-12 11:56 | 34M |
| The most evil women in history.pdf | 2024-06-12 11:57 | 11M |
| The movie book.pdf | 2021-05-18 18:56 | 57M |
| The New Oxford Book of Literary Anecdotes.pdf | 2023-08-31 18:50 | 4.8M |
| The New York Times Book of Wine - More Than 30 years of Vintage Writing.pdf | 2022-10-03 01:04 | 22M |
| The official dictionary of sarcasm.pdf | 2021-05-16 11:07 | 11M |
| The Oxford book of aphorisms.pdf | 2021-10-04 00:20 | 19M |
| The Oxford book of gothic tales.pdf | 2021-10-04 10:53 | 74M |
| The Oxford book of modern science writing.pdf | 2021-10-04 00:19 | 16M |
| The Oxford book of parodies.pdf | 2021-10-04 10:54 | 19M |
| The Oxford book of royal anecdotes.pdf | 2021-10-04 00:08 | 27M |
| The Oxford book of scary tales.pdf | 2021-05-29 17:16 | 36M |
| The Oxford Handbook of Innovation.pdf | 2021-12-25 22:04 | 53M |
| The People in the Castle - Selected Strange Stories.pdf | 2022-09-04 19:46 | 11M |
| The Pocket Oxford Guide to Sailing Terms.pdf | 2022-10-03 01:03 | 32M |
| The SAS Self-Defense Handbook (John Lofty Wiseman).pdf | 2019-03-31 13:31 | 45M |
| The secret history of fantasy.pdf | 2023-01-06 00:15 | 18M |
| The Ubiquitous Pig.pdf | 2021-05-30 17:18 | 28M |
| The World's Major Languages.pdf | 2021-07-23 12:06 | 38M |
| The World encyclopedia of cartoons.pdf | 2021-05-28 13:55 | 48M |
| Three Men in a Boat & Three Men on the Bummel.pdf | 2021-09-28 09:37 | 1.6M |
| time.doc | 2007-02-21 13:12 | 102K |
| time.odt | 2007-02-21 13:05 | 15K |
| Timothy Leary - What Does Woman Want.pdf | 2021-07-08 13:26 | 19M |
| Totalitarian Science and Technology.pdf | 2021-06-10 20:19 | 1.2M |
| Understanding Marijuana - a new look at the scientific evidence.pdf | 2021-08-05 17:21 | 12M |
| unicode.bmp | 2021-11-12 23:34 | 2.0M |
| vorwarts.jpg | 2021-02-08 15:44 | 119K |
![[TXT]](/icons/text.gif) | vremena.txt | 2013-01-30 00:20 | 7.2K |
| Wild sex - the science behind mating in the animal kingdom, Bondar 2015.pdf | 2023-03-02 00:27 | 18M |
| William Safire - 1989 - Words of wisdom.pdf | 2021-07-22 20:45 | 24M |
| witj.doc | 2007-06-02 11:18 | 28K |
| witj.odt | 2007-05-06 15:05 | 14K |
| Words.doc | 2005-12-03 13:15 | 1.1M |
| Wordsworth's guide to the lakes, 5ed 1835.pdf | 2022-12-09 00:45 | 13M |
| Worlds end and other stories.pdf | 2021-06-04 14:50 | 10M |
| x_2273dac4.jpg | 2020-11-23 00:04 | 74K |
| Zen and the Art of Motorcycle Maintenance - An Inquiry into Values.pdf | 2021-11-08 15:04 | 943K |
| Zen and the Art of Motorcycle Maintenance.pdf | 2022-07-31 22:32 | 42M |
| Zen and the Art of Motorcycle Maintenance alt.pdf | 2021-11-08 15:04 | 1.3M |
| _buylist.txt | 2019-02-03 11:47 | 72 |
|
|---|
![[IMG]](8bit.jpg)
![[IMG]](1612343739-711703565efb87d63d4ea047613b0bcc.jpeg)
![[IMG]](advisland.jpg)
![[IMG]](alphabet.jpg)
![[IMG]](alphabet2.jpg)
![[IMG]](dope.jpg)
![[IMG]](indicasativa.jpg)
![[IMG]](lovecraft.png)
![[IMG]](movies.png)
![[IMG]](pfukmoyTbnk.jpg)
![[IMG]](poe%20lovecraft.jpg)
![[IMG]](saint%20robots.jpg)
![[IMG]](unicode.bmp)
![[IMG]](vorwarts.jpg)
![[IMG]](x_2273dac4.jpg)