![[ICO]](/icons/blank.gif) | Name | Last modified | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - |
![[IMG]](/icons/image2.gif) | Александров В.Н., Емельянов В.И. отравлие вещества - 1991.djvu | 2011-10-19 00:38 | 2.6M |
| Александров--отравляющие_вещества.djvu | 2019-11-13 07:18 | 2.6M |
| К. Лос Синтетические яды.djvu | 2011-10-18 23:16 | 1.7M |
![[ ]](/icons/unknown.gif) | Федоров Л.А. От хлора и фосгена до «Новичка». История советского химического оружия. 2019.fb2 | 2019-03-15 21:25 | 4.7M |
| Франке.Химия боевых отравляющих веществ.djvu | 2019-11-13 03:58 | 6.0M |
![[ ]](/icons/layout.gif) | A Higher Form of Killing - The Secret History of Chemical and Biological Warfare, Paxman 1ed 1982.pdf | 2022-12-13 00:42 | 18M |
| A Higher Form of Killing - The Secret History of Chemical and Biological Warfare, Paxman 2ed 2002.pdf | 2022-12-13 00:12 | 20M |
| A History of Chemical and Biological Weapons, Spiers 2010.pdf | 2023-01-06 00:13 | 11M |
| antonov_khimicheskoe oruzhie na rubezhe dvukh stoletiy.djvu | 2012-11-30 06:20 | 4.3M |
| antonov_raz.djvu | 2016-02-14 22:29 | 4.8M |
| Barceloux D.G. Toxicology Of Natural Substances, Foods, Fungi, Medicinal Herbs, Plants, and Venomous Animals (Wiley, 2008).pdf | 2011-09-11 16:47 | 17M |
| Blyth A.W. - Poisons- Their effect and detection 1906.pdf | 2011-04-08 04:22 | 13M |
| Chemical & Biological Weapons in our Times, Levine 2000.pdf | 2023-02-28 13:28 | 5.1M |
| Chemical and biological warfare, Landau 1991.pdf | 2023-02-28 15:03 | 5.9M |
| Chemical and biological warfare - a reference handbook, Mauroni 2003.pdf | 2023-02-28 14:57 | 13M |
| Chemical and biological warfare - the cruelest weapons, Pringle 2000.pdf | 2023-02-28 14:59 | 8.0M |
| Chemical and biological warfare a comprehensive survey for the concerned citizen, Croddy 2002.pdf | 2020-12-28 19:24 | 62M |
| Chemicals for Crop Improvement and Pest Management, Green 3ed 1987.pdf | 2022-10-14 01:37 | 20M |
| Chemical soldiers - British gas warfare in World War I, Richter 1992.pdf | 2023-02-28 15:06 | 17M |
| Chemical Warfare, Frier West 1921.pdf | 2020-12-28 19:41 | 32M |
| Chemical warfare, Spears 1986.pdf | 2023-02-28 15:07 | 9.4M |
| Chemical Warfare, Spiers 1986.pdf | 2020-12-28 19:28 | 9.4M |
| chemicalwarfarea112rens.pdf | 2020-12-28 18:57 | 290M |
| Chemical Warfare Agents; Chemistry, Pharmacology, Toxicology, and Therapeutics, Second Edition.pdf | 2021-09-20 17:06 | 13M |
| Fatal airs - the deadly history and apocalyptic future of lethal gases that threaten our world, Christiansen 2010.pdf | 2023-02-28 18:09 | 8.2M |
| Fedorov_L_A_Khimicheskoe_vooruzhenie_Tom_1_Dolgiy_put_k_khimicheskoy_voyne_2009.pdf | 2021-09-30 18:52 | 2.7M |
| Fedorov_L_A_Khimicheskoe_vooruzhenie_Tom_2_Voenno-khimicheskiy_arkhipelag_2009.pdf | 2021-09-30 18:52 | 1.6M |
| Fedorov_L_A_Khimicheskoe_vooruzhenie_Tom_3_Ekologia_khimicheskogo_oruzhia_2009.pdf | 2021-09-30 18:52 | 2.7M |
| franke1.djvu | 2016-02-21 22:04 | 4.7M |
| franke2.djvu | 2016-02-21 22:04 | 4.1M |
| Franke2a.djvu | 2006-04-06 09:31 | 1.1M |
| Franke2b.djvu | 2006-04-06 09:39 | 1.2M |
| Franke2c.djvu | 2006-04-06 09:46 | 967K |
| Franke2d.djvu | 2006-04-06 09:53 | 938K |
| Gas! Gas! Quick, boys! - how chemistry changed the First World War, Freemantle 2012.pdf | 2023-02-28 18:30 | 17M |
| Gas and Flame in Modern Warfare, Auld 1918.pdf | 2020-12-28 19:46 | 10M |
| Handbook-Of-Chemical-And-Biological-Warfare-Agents.pdf | 2016-02-21 22:06 | 4.6M |
| Handbook.of.Chemical.and.Biological.Warfare.Agents.pdf | 2020-12-28 18:12 | 5.0M |
| Handbook of chemical warfare and terrorism, Hoenig 2002.pdf | 2023-02-28 18:26 | 8.1M |
| Handbook of chemical warfare and terrorism.pdf | 2020-12-28 19:14 | 8.2M |
| Handbook of Highly Toxic Materials Handling and Management - By Grossel.pdf | 2011-12-24 07:10 | 159M |
| Handbook of industrial toxicology.pdf | 2024-06-12 11:53 | 17M |
| Handbook_Of_Chemical_And_Biological_Warfare_Agents_Hank_Ellison.pdf | 2020-12-28 18:13 | 4.6M |
| Handbook_on_the_Toxicology_of_Metals_3rd_edition.pdf | 2012-08-09 23:59 | 8.3M |
| Himija_OV-Franke-1.djvu | 2011-10-19 00:52 | 6.0M |
| Himija_OV-Franke-2.djvu | 2011-10-19 00:53 | 4.1M |
| irritants.pdf | 2016-02-21 22:07 | 4.2M |
| King of poisons - a history of arsenic.pdf | 2024-06-12 11:57 | 11M |
| Lethal mists - an introduction to the natural and military science, Taylor 2009.pdf | 2023-02-28 18:24 | 22M |
| Mercury Poisoning I, 1973.pdf | 2022-09-11 19:04 | 8.8M |
| Molecules of Death, 2 ed - Waring.pdf | 2019-11-14 14:15 | 17M |
| Molecules of Death_2rd ed_2007.pdf | 2011-04-08 04:23 | 17M |
| Molecules of murder - criminal molecules and classic cases, Emsley 2008.pdf | 2023-02-28 18:19 | 18M |
| NBC - nuclear, biological, and chemical warfare on the modern battlefield, Norris 1997.pdf | 2023-02-28 18:16 | 10M |
| Nekrasov-Chimija-OV.djvu | 2016-02-21 21:20 | 1.9M |
| No fire, no thunder - the threat of chemical and biological weapons, Murphy 1984.pdf | 2023-02-28 18:13 | 7.6M |
| novichok.jpg | 2025-03-13 20:24 | 850K |
| Poisoned lives - English poisoners and their victims, Watson.pdf | 2023-03-07 22:35 | 11M |
| sintezy-otravl_yuschih-veschestv-soborovskiy-19362.djvu | 2013-08-09 20:04 | 2.6M |
| Soborovskij_Jakubovich_Sintezi_Otravlaushih_Veshestv.djvu | 2012-04-14 02:41 | 2.1M |
| The Admiral's secret weapon - Lord Dundonald and the origins of chemical warfare, Stephenson 2006.pdf | 2023-03-02 00:47 | 12M |
| The Encyclopedia of Poisons and Antidotes_3rd_Ed_2010.pdf | 2011-04-08 04:23 | 4.4M |
| The fourth horseman - one mans secret mission to wage the Great War in America, Koenig 2006.pdf | 2023-03-02 00:45 | 28M |
| The Inheritor's Powder - A Tale of Arsenic, Murder, and the New Forensic Science, Hempel.pdf | 2023-03-07 22:41 | 9.5M |
| The killing factory - the top secret world of germ and chemical warfare, Parker 1996.pdf | 2023-03-02 00:43 | 9.6M |
| The Poisoner's Handbook - Murder and the Birth of Forensic Medicine in Jazz Age New York, Blum 2010.pdf | 2023-03-07 22:36 | 15M |
| the poison war.pdf | 2020-12-28 20:35 | 7.2M |
| The Soviet biological weapons program - a history, Leitenberg 2012.pdf | 2023-03-02 00:46 | 52M |
| The_War_Gases_Chemistry_and_Analysis_Sartori.pdf | 2020-12-28 18:24 | 4.2M |
| Toxicological chemistry - a guide to toxic substances in chemistry, Manahan 2ed 1992.pdf | 2021-08-05 21:06 | 36M |
| Toxicological chemistry - a guide to toxic substances in chemistry, Manahan 1989.pdf | 2021-08-05 21:04 | 12M |
| Toxicology - the basic science of poisons, Casarett and Doull.pdf | 2024-06-12 11:54 | 149M |
| Toxic warfare, Karasik 2002.pdf | 2023-03-02 00:40 | 3.4M |
| Unit 731 - testimony, Gold 1996.pdf | 2023-03-02 00:38 | 16M |
| War Gases, Jacobs 1942.pdf | 2020-12-28 19:37 | 13M |
| War of nerves, Tucker 2006.pdf | 2023-01-06 00:10 | 28M |
| Yellow rain - a journey through the terror of chemical warfare, Seagrave 1981.pdf | 2023-03-02 00:35 | 11M |
|
|---|
![[IMG]](novichok.jpg)