![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](folder.jpg)
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| scans/ | 2020-11-15 21:00 | - |
| 01 - In Those Times.mp3 | 2020-11-15 21:11 | 17M |
| 02 - Which Is This.mp3 | 2020-11-15 21:11 | 8.1M |
| 03 - Pinky Pigs.mp3 | 2020-11-15 21:11 | 12M |
| 04 - Doctor Martin.mp3 | 2020-11-15 21:11 | 8.4M |
| 05 - I'm Lying on My Belly.mp3 | 2020-11-15 21:11 | 11M |
| 06 - Eyes Look From the Mount of Flash.mp3 | 2020-11-15 21:11 | 18M |
| 07 - Chemical New York.mp3 | 2020-11-15 21:11 | 15M |
| 08 - Adlerbar.mp3 | 2020-11-15 21:11 | 11M |
| 09 - Catch Me.mp3 | 2020-11-15 21:11 | 15M |
| 10 - The Wanderer.mp3 | 2020-11-15 21:11 | 30M |
| folder.jpg | 2020-11-15 19:00 | 144K |
| information.txt | 2020-11-15 19:00 | 8.8K |
| tracks.txt | 2020-11-15 19:00 | 337 |