![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](1967-1.jpg)
![[IMG]](1967.jpg)
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| 01 Reaction in G.mp3 | 2017-06-19 14:14 | 14M |
| 02 Arnold Layne.mp3 | 2017-06-16 16:35 | 7.6M |
| 03 One in a Million.mp3 | 2017-06-20 02:56 | 15M |
| 04 Maltilda Mother.mp3 | 2017-06-16 17:16 | 14M |
| 05 Scream Thy Last Scream.mp3 | 2017-06-16 15:26 | 14M |
| 06 Astronomy Domine.mp3 | 2017-06-16 15:02 | 16M |
| 07 Interstellar Overdrive.mp3 | 2017-06-20 02:20 | 9.5M |
| 08 Reaction in G.mp3 | 2017-06-15 09:18 | 1.2M |
| 09 Set the Controls For The Heart.mp3 | 2017-06-16 16:11 | 7.5M |
| 10 Astronomy Domine.mp3 | 2017-06-16 05:20 | 8.5M |
| 11 Interstellar Overdrive.mp3 | 2017-06-20 04:08 | 33M |
| 1967-1.jpg | 2017-06-16 16:14 | 2.1M |
| 1967.jpg | 2017-06-15 08:39 | 1.9M |