![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](Sono---Front.jpg)
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| Sono---Front.jpg | 2021-10-25 05:49 | 47K |
| 01 - Snow.mp3 | 2021-11-15 15:59 | 2.5M |
| 02 - 2000 Guns.mp3 | 2021-11-15 15:59 | 7.9M |
| 03 - Since You're Gone.mp3 | 2021-11-15 15:59 | 9.5M |
| 04 - Breaking the Bridges.mp3 | 2021-11-15 15:59 | 10M |
| 05 - Keep Control.mp3 | 2021-11-15 15:59 | 8.1M |
| 06 - Red Sky.mp3 | 2021-11-15 15:59 | 7.7M |
| 07 - Blame.mp3 | 2021-11-15 15:59 | 7.3M |
| 08 - God's Town.mp3 | 2021-11-15 15:59 | 6.6M |
| 09 - Movin' On.mp3 | 2021-11-15 15:59 | 9.3M |
| 10 - So Restless.mp3 | 2021-11-15 15:59 | 8.8M |
| 11 - Alto Drive.mp3 | 2021-11-15 15:59 | 7.9M |
| 12 - Still the Drug.mp3 | 2021-11-15 15:59 | 13M |
| 13 - Wherever You Go.mp3 | 2021-11-15 15:59 | 9.4M |