![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](folder.jpeg)
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| Covers/ | 2025-02-22 22:05 | - |
| 01 - Raj Na Plaży = the Beach.mp3 | 2025-02-26 22:32 | 9.8M |
| 02 - Trzeci Z Kolei = the Third One.mp3 | 2025-02-26 22:32 | 13M |
| 03 - Będziemy Mieli Windę = We'll Have a Lift.mp3 | 2025-02-26 22:32 | 9.8M |
| 04 - Sekwens = Sequence.mp3 | 2025-02-26 22:32 | 11M |
| 05 - Happy End.mp3 | 2025-02-26 22:32 | 9.7M |
| 06 - Porwanie Dorożki = Snatching at a Cab.mp3 | 2025-02-26 22:32 | 6.5M |
| 07 - Oczekiwanie = Expectation.mp3 | 2025-02-26 22:32 | 10M |
| 08 - Relaks = Relax.mp3 | 2025-02-26 22:32 | 7.8M |
| 09 - Komplet = a Group.mp3 | 2025-02-26 22:32 | 7.1M |
| 10 - Ixi Zamiast Dixi = Ixi Instead of Dixie.mp3 | 2025-02-26 22:32 | 7.8M |
| 11 - Wino Z Makaronem = Wine and Macaroni.mp3 | 2025-02-26 22:32 | 11M |
| folder.jpeg | 2018-01-13 16:35 | 119K |