![[ICO]](/icons/blank.gif) | Name | Last modified | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - |
![[DIR]](/icons/folder.gif) | Heraldry of Heroism/ | 2021-04-03 10:23 | - |
![[ ]](/icons/layout.gif) | War_Slang.pdf | 2019-03-31 13:29 | 190M |
| Говорухин А.М_Куприн А.М_Камезо М.В_Справочник по военной топографии_М_Воениздат_1973.pdf | 2017-08-06 01:27 | 125M |
| mityaev_av01.pdf | 2021-03-24 22:46 | 94M |
| Иллюстрированный военно-технический словарь.pdf | 2022-12-15 17:34 | 85M |
| Richard Holmes - The Second World War in photographs.pdf | 2021-12-12 13:37 | 65M |
| A_Basic_Manual_of_Military_Small_Arms_How_to_Load_Operate_Disassemble_Assemble.pdf | 2020-12-28 21:40 | 59M |
| Russian Fortresses 1480-1682.pdf | 2022-11-16 20:29 | 52M |
| D_Ushakov_Prosteyshie_bytovye_i_khozyaystvennye_postroyki_dlya_voysk_v_polevykh_usloviakh_1940.pdf | 2017-09-22 01:36 | 43M |
![[IMG]](/icons/image2.gif) | Военная топография - 1947.djvu | 2016-02-21 22:11 | 43M |
| Zorndorf 1758 Frederick faces Holy Mother Russia.pdf | 2022-11-16 20:30 | 42M |
| The Uniforms of the World's Great Armies - 1700 to the Present.pdf | 2022-09-28 23:56 | 36M |
| Richard Holmes - Fatal Avenue - a traveller's history of the battlefields of Northern France and Flanders.pdf | 2021-12-12 13:39 | 34M |
| Russian Battleship vs Japanese Battleship.pdf | 2022-11-16 20:30 | 34M |
![[ ]](/icons/unknown.gif) | maker-s-guide-to-the-zombie-apocalypse-defend-your-base-with-simple-circuits-ard_RuLit_Me_447045.fb2 | 2016-10-09 15:52 | 34M |
| Uniforms of the World - A Compendium of Army, Navy, and Air Force Uniforms, Knotel.pdf | 2022-09-29 01:11 | 33M |
| Richard Holmes - Redcoat - the British soldier in the age of horse and musket.pdf | 2021-12-12 13:38 | 33M |
| Richard Holmes - Sahib - the British soldier in India, 1750-1914.pdf | 2021-12-12 13:38 | 32M |
| Richard Holmes - The world at war.pdf | 2021-12-12 13:36 | 30M |
| The Military and Society in Russia 1450-1917 (History of Warfare #14).pdf | 2022-11-16 20:26 | 28M |
| Бубнов И.А., Кремп А.И., Калинин А.К., Шленников С.А. - Военная топография - 1969.pdf | 2016-02-21 22:12 | 28M |
| Heraldry & Regalia of War.pdf | 2022-09-29 00:02 | 27M |
| Glossary of soviet military terminology.pdf | 2025-05-07 00:09 | 26M |
| Richard Holmes - Dusty warriors - modern soldiers at war.pdf | 2021-12-12 13:38 | 23M |
| Modern Military Uniforms.pdf | 2022-09-28 23:57 | 21M |
| The Imperial Guard of Russia 1900-1914.pdf | 2022-11-16 20:20 | 20M |
| Richard Holmes - Acts of war - the behavior of men in battle.pdf | 2021-12-12 15:08 | 19M |
| Ермолаев А.Д., Иrнатенко В.В., Кобозов А.И. - Военная топография. Пособие для танкистов - 1969.pdf | 2016-02-21 22:12 | 19M |
| Usmc-SmallWarsManual19401990rprnt-1.pdf | 2016-11-10 17:51 | 18M |
| Richard Holmes - Battlefields of the Second World War.pdf | 2021-12-12 13:40 | 18M |
| Clausewitz - On War.pdf | 2021-12-13 12:00 | 18M |
| Russian Army of the Seven Years War.pdf | 2022-11-16 20:30 | 17M |
| A Civilian's Guide to the U.S. Military.pdf | 2022-10-01 00:34 | 17M |
| Opoznavatelnye_znaki_vooruzhennykh_sil_SShA.pdf | 2016-03-25 14:50 | 17M |
| Identifying Military Insignia, Fowler 1993.pdf | 2022-10-01 00:54 | 17M |
| American Military Insignia.pdf | 2022-09-29 00:58 | 17M |
| Posters of World War Two, Judd 1972.pdf | 2022-09-15 23:35 | 16M |
| Illustrated Catalog of Civil War Military Goods - Union Weapons, Insignia, Uniform Accessories and Other Equipment.pdf | 2022-10-01 00:39 | 15M |
| 20th Century Military Uniforms.pdf | 2022-09-28 23:57 | 15M |
| Russian Grenadiers and Infantry 1799-1815.pdf | 2022-11-16 20:27 | 14M |
| The Russian Army 1914-18.pdf | 2022-11-16 20:15 | 14M |
| ARN1575_DAPam670-1_Web_FINAL.pdf | 2019-01-24 22:25 | 14M |
| Armored Units of the Russian Civil War White and Allied.pdf | 2022-11-16 20:12 | 13M |
| Справочник офицера инженерных войск. Колибернов 1989.pdf | 2016-02-15 00:14 | 13M |
| Richard Holmes - Battle.pdf | 2021-12-12 13:40 | 12M |
| Armored Units of the Russian Civil War Red Army.pdf | 2022-11-16 20:30 | 11M |
| uniformregulatio00unit.pdf | 2019-01-24 19:38 | 10M |
| Polevye_neoboronitelnye_postroyki_RKKA_1941_god_pdf.pdf | 2017-09-22 01:31 | 10M |
| Army Regulation 840–10.pdf | 2019-01-24 22:32 | 9.2M |
| 1941UniformsInsigniaForeignNavies.pdf | 2019-01-24 18:05 | 8.1M |
| klyuev_nemetskie boepripasy.djvu | 2012-11-30 06:26 | 8.0M |
| Explosive_Principles_by_Robert_Sickler.pdf | 2020-12-28 21:31 | 7.8M |
| Soborovsky.djvu | 2016-02-21 22:00 | 7.0M |
| voen-top.djvu | 2016-02-21 22:12 | 5.8M |
| A_Afanasyev_V_pomosch_partizanu_1942.djvu | 2018-02-02 00:25 | 5.8M |
| min oborony sssr_rukovodstvo po podryvnym rabotam.djvu | 2012-11-30 06:27 | 5.4M |
| Ministerstvo-oborony-SSSR_120-mm-minomet-obr-1938-g-Rukovodstvo-sluzhby_RuLit_Me.fb2 | 2016-08-16 16:16 | 5.4M |
| D Hank Ellison Handbook Of Chemical And Biological Warfare Agents Crc Press 1999.pdf | 2021-09-21 01:56 | 4.6M |
| Clausewitz - On War, Books 1 and 8.pdf | 2021-12-13 11:59 | 4.5M |
| North Korean Army.pdf | 2022-10-01 18:23 | 4.0M |
| 1943RankAndBadges.pdf | 2019-01-24 19:33 | 3.8M |
| 1943UniformInsignia.pdf | 2019-01-24 17:51 | 3.7M |
| Ministerstvo-oborony-SSSR_30-mm-avtomaticheskiy-granatomet-na-stanke-AGS-17-.ziVoYQ_RuLit_Me.fb2 | 2016-09-25 04:27 | 3.6M |
| The Concise Illustrated book of Military Badges and Insignia.pdf | 2022-09-29 01:14 | 3.5M |
| 6fKzHCh.jpg | 2017-11-20 01:01 | 3.3M |
| GAU-RKKA_50-mm-rotnyy-minomet-obr-1940-g-_RuLit_Me.fb2 | 2016-08-10 18:20 | 2.9M |
| Paramilitary_and_Nonmilitary_Organization_and_Tactics_FM_31-91.3.pdf | 2019-03-30 01:16 | 2.9M |
| Ministerstvo-oborony-SSSR_Perenosnoy-protivotankovyy-kompleks-9K11-Tehnicheskoe-opisanie-i-instrukciya-po-ekspluatacii_RuLit_Me.fb2 | 2016-06-01 10:16 | 2.6M |
| CleanedUOSSSimpleSabotage_sm.pdf | 2018-01-21 23:41 | 2.4M |
| soborovsky1936.djvu | 2016-02-21 22:01 | 2.1M |
| migrina_artilleriyskie porokha i zaryady_.djvu | 2012-11-30 06:27 | 1.9M |
| FM19-151964.pdf | 2019-03-29 23:45 | 1.8M |
| Epihin_Revolvery-Smitta-Vessona-sostoyashchie-na-vooruzhenii-russkih-voysk.-7zBRg_RuLit_Me.fb2 | 2016-09-19 22:19 | 1.7M |
| Газета-Красная-звезда.-Погоны-1943-1.pdf | 2016-03-25 13:00 | 1.5M |
| Yady_-_vchera_i_segodnya_Gadaskina_pdf.pdf | 2017-01-07 18:32 | 1.0M |
| 001 Federal Agency Buttons 001.jpg | 2019-01-24 19:31 | 295K |
| 6BVQ4Sfn8Yk.jpg | 2016-05-01 14:15 | 169K |
| photos_text_twocol_c.jpg | 2016-05-01 14:15 | 130K |
| Potapov_Borba_s_diversantami_RuLit_Net.fb2 | 2011-10-18 01:30 | 117K |
| 0IJlg-AtN2Q.jpg | 2017-12-03 22:14 | 63K |
| army1.gif | 2019-01-24 19:32 | 45K |
| Ministerstvo-oborony-SSSR_12-7-mm-pulemety-obr-1938-46-g-i-1938-g-Nastavlenie-po-strelkovomu-delu.Wz0bXA_RuLit_Me.fb2 | 2016-11-11 15:43 | 0 |
|
|---|
![[IMG]](6fKzHCh.jpg)
![[IMG]](001%20Federal%20Agency%20Buttons%20001.jpg)
![[IMG]](6BVQ4Sfn8Yk.jpg)
![[IMG]](photos_text_twocol_c.jpg)
![[IMG]](0IJlg-AtN2Q.jpg)
![[IMG]](army1.gif)